C25H30F3N3O3S2 — CID 46098070
1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazole (PubChem CID 46098070) has the molecular formula C25H30F3N3O3S2 and a molecular weight of 541.66 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazole.
| Compound Name | 1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazole |
|---|---|
| PubChem CID | 46098070 |
| Molecular Formula | C25H30F3N3O3S2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonyl-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazole |
| SMILES | CCOCCCn1c(SCc2c(F)ccc(F)c2F)nc2cc(S(=O)(=O)N3CCCC(C)C3)ccc21 |
| InChI | InChI=1S/C25H30F3N3O3S2/c1-3-34-13-5-12-31-23-10-7-18(36(32,33)30-11-4-6-17(2)15-30)14-22(23)29-25(31)35-16-19-20(26)8-9-21(27)24(19)28/h7-10,14,17H,3-6,11-13,15-16H2,1-2H3 |
| InChIKey | JWGAQDQMSHQJFL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|