C26H32N4O3S2 — CID 92773322
4-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzonitrile (PubChem CID 92773322) has the molecular formula C26H32N4O3S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 4-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzonitrile.
| Compound Name | 4-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 92773322 |
| Molecular Formula | C26H32N4O3S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzonitrile |
| SMILES | CCOCCCn1c(SCc2ccc(C#N)cc2)nc2cc(S(=O)(=O)N3CCC[C@H](C)C3)ccc21 |
| InChI | InChI=1S/C26H32N4O3S2/c1-3-33-15-5-14-30-25-12-11-23(35(31,32)29-13-4-6-20(2)18-29)16-24(25)28-26(30)34-19-22-9-7-21(17-27)8-10-22/h7-12,16,20H,3-6,13-15,18-19H2,1-2H3/t20-/m0/s1 |
| InChIKey | QWUAOXFDHNUPEH-FQEVSTJZSA-N |
| XLogP | 5.05 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|