C27H35N3O5S2 — CID 98182564
methyl 3-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 98182564) has the molecular formula C27H35N3O5S2 and a molecular weight of 545.73 g/mol. Its IUPAC name is methyl 3-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 3-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 98182564 |
| Molecular Formula | C27H35N3O5S2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | methyl 3-[[1-(3-ethoxypropyl)-5-[(3S)-3-methylpiperidin-1-yl]sulfonylbenzimidazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | CCOCCCn1c(SCc2cccc(C(=O)OC)c2)nc2cc(S(=O)(=O)N3CCC[C@H](C)C3)ccc21 |
| InChI | InChI=1S/C27H35N3O5S2/c1-4-35-15-7-14-30-25-12-11-23(37(32,33)29-13-6-8-20(2)18-29)17-24(25)28-27(30)36-19-21-9-5-10-22(16-21)26(31)34-3/h5,9-12,16-17,20H,4,6-8,13-15,18-19H2,1-3H3/t20-/m0/s1 |
| InChIKey | ZNZVTZYXYYEYOF-FQEVSTJZSA-N |
| XLogP | 4.96 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|