C27H37N3O4S2 — CID 46096457
2-[(4-ethoxyphenyl)methylsulfanyl]-1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazole (PubChem CID 46096457) has the molecular formula C27H37N3O4S2 and a molecular weight of 531.74 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methylsulfanyl]-1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazole.
| Compound Name | 2-[(4-ethoxyphenyl)methylsulfanyl]-1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazole |
|---|---|
| PubChem CID | 46096457 |
| Molecular Formula | C27H37N3O4S2 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methylsulfanyl]-1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazole |
| SMILES | CCOCCCn1c(SCc2ccc(OCC)cc2)nc2cc(S(=O)(=O)N3CCCC(C)C3)ccc21 |
| InChI | InChI=1S/C27H37N3O4S2/c1-4-33-17-7-16-30-26-14-13-24(36(31,32)29-15-6-8-21(3)19-29)18-25(26)28-27(30)35-20-22-9-11-23(12-10-22)34-5-2/h9-14,18,21H,4-8,15-17,19-20H2,1-3H3 |
| InChIKey | WQRTZRKPISFBBC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|