C16H21N3O3S2 — CID 7506967
4-(1-ethyl-2-prop-2-enylsulfanylbenzimidazol-5-yl)sulfonylmorpholine (PubChem CID 7506967) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-(1-ethyl-2-prop-2-enylsulfanylbenzimidazol-5-yl)sulfonylmorpholine.
| Compound Name | 4-(1-ethyl-2-prop-2-enylsulfanylbenzimidazol-5-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 7506967 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-(1-ethyl-2-prop-2-enylsulfanylbenzimidazol-5-yl)sulfonylmorpholine |
| SMILES | C=CCSc1nc2cc(S(=O)(=O)N3CCOCC3)ccc2n1CC |
| InChI | InChI=1S/C16H21N3O3S2/c1-3-11-23-16-17-14-12-13(5-6-15(14)19(16)4-2)24(20,21)18-7-9-22-10-8-18/h3,5-6,12H,1,4,7-11H2,2H3 |
| InChIKey | ZOKBADFYJVDBTD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|