C22H25N3O5S2 — CID 40606737
methyl 4-[(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 40606737) has the molecular formula C22H25N3O5S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl 4-[(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 40606737 |
| Molecular Formula | C22H25N3O5S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | methyl 4-[(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | CCn1c(SCc2ccc(C(=O)OC)cc2)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C22H25N3O5S2/c1-3-25-20-9-8-18(32(27,28)24-10-12-30-13-11-24)14-19(20)23-22(25)31-15-16-4-6-17(7-5-16)21(26)29-2/h4-9,14H,3,10-13,15H2,1-2H3 |
| InChIKey | ORRJCFYEDAIVON-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |