C22H33N3O6S — CID 55354979
2-ethoxyethyl 3-(1-butyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)propanoate (PubChem CID 55354979) has the molecular formula C22H33N3O6S and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-ethoxyethyl 3-(1-butyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)propanoate.
| Compound Name | 2-ethoxyethyl 3-(1-butyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)propanoate |
|---|---|
| PubChem CID | 55354979 |
| Molecular Formula | C22H33N3O6S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-ethoxyethyl 3-(1-butyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)propanoate |
| SMILES | CCCCn1c(CCC(=O)OCCOCC)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C22H33N3O6S/c1-3-5-10-25-20-7-6-18(32(27,28)24-11-13-30-14-12-24)17-19(20)23-21(25)8-9-22(26)31-16-15-29-4-2/h6-7,17H,3-5,8-16H2,1-2H3 |
| InChIKey | ABEFKUGYIDYGJZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|