C20H30N4O3S2 — CID 4883887
1-butyl-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide (PubChem CID 4883887) has the molecular formula C20H30N4O3S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 1-butyl-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide.
| Compound Name | 1-butyl-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 4883887 |
| Molecular Formula | C20H30N4O3S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-butyl-2-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(SCC(=O)N2CCCCC2CC)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H30N4O3S2/c1-3-5-11-24-18-10-9-16(29(21,26)27)13-17(18)22-20(24)28-14-19(25)23-12-7-6-8-15(23)4-2/h9-10,13,15H,3-8,11-12,14H2,1-2H3,(H2,21,26,27) |
| InChIKey | FGGNGTMVTJHDQN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |