C19H28N4O3S2 — CID 8926880
1-butyl-2-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]sulfanylbenzimidazole-5-sulfonamide (PubChem CID 8926880) has the molecular formula C19H28N4O3S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-butyl-2-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]sulfanylbenzimidazole-5-sulfonamide.
| Compound Name | 1-butyl-2-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]sulfanylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 8926880 |
| Molecular Formula | C19H28N4O3S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1-butyl-2-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]sulfanylbenzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(S[C@@H](C)C(=O)N2CCCCC2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H28N4O3S2/c1-3-4-12-23-17-9-8-15(28(20,25)26)13-16(17)21-19(23)27-14(2)18(24)22-10-6-5-7-11-22/h8-9,13-14H,3-7,10-12H2,1-2H3,(H2,20,25,26)/t14-/m0/s1 |
| InChIKey | CLOMKTAFTTYYEV-AWEZNQCLSA-N |
| XLogP | 2.98 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |