C23H29N5O3S2 — CID 4812089
1-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylbenzimidazole-5-sulfonamide (PubChem CID 4812089) has the molecular formula C23H29N5O3S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 1-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylbenzimidazole-5-sulfonamide.
| Compound Name | 1-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 4812089 |
| Molecular Formula | C23H29N5O3S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 1-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylbenzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(SCC(=O)N2CCN(c3ccccc3)CC2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H29N5O3S2/c1-2-3-11-28-21-10-9-19(33(24,30)31)16-20(21)25-23(28)32-17-22(29)27-14-12-26(13-15-27)18-7-5-4-6-8-18/h4-10,16H,2-3,11-15,17H2,1H3,(H2,24,30,31) |
| InChIKey | VXURONREIMKGSO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |