C24H28N4O2S — CID 4812097
3-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one (PubChem CID 4812097) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 3-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 4812097 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-butyl-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one |
| SMILES | CCCCn1c(SCC(=O)N2CCN(c3ccccc3)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H28N4O2S/c1-2-3-13-28-23(30)20-11-7-8-12-21(20)25-24(28)31-18-22(29)27-16-14-26(15-17-27)19-9-5-4-6-10-19/h4-12H,2-3,13-18H2,1H3 |
| InChIKey | PXYDYFNCRUQRHX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |