C16H21N3OS — CID 17413749
2-(1-methylbenzimidazol-2-yl)sulfanyl-1-(3-methylpiperidin-1-yl)ethanone (PubChem CID 17413749) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)sulfanyl-1-(3-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-(1-methylbenzimidazol-2-yl)sulfanyl-1-(3-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 17413749 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)sulfanyl-1-(3-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCN(C(=O)CSc2nc3ccccc3n2C)C1 |
| InChI | InChI=1S/C16H21N3OS/c1-12-6-5-9-19(10-12)15(20)11-21-16-17-13-7-3-4-8-14(13)18(16)2/h3-4,7-8,12H,5-6,9-11H2,1-2H3 |
| InChIKey | QMCJNXSIHREZCG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |