C17H21N3O2S — CID 7421358
3-methyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 7421358) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-methyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-methyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 7421358 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-methyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | C[C@H]1CCCN(C(=O)CSc2nc3ccccc3c(=O)n2C)C1 |
| InChI | InChI=1S/C17H21N3O2S/c1-12-6-5-9-20(10-12)15(21)11-23-17-18-14-8-4-3-7-13(14)16(22)19(17)2/h3-4,7-8,12H,5-6,9-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | UJLTWQFERYCZKH-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |