C15H21N3O4S2 — CID 7488126
butyl 2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetate (PubChem CID 7488126) has the molecular formula C15H21N3O4S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is butyl 2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetate.
| Compound Name | butyl 2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7488126 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | butyl 2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetate |
| SMILES | CCCCOC(=O)CSc1nc2cc(S(N)(=O)=O)ccc2n1CC |
| InChI | InChI=1S/C15H21N3O4S2/c1-3-5-8-22-14(19)10-23-15-17-12-9-11(24(16,20)21)6-7-13(12)18(15)4-2/h6-7,9H,3-5,8,10H2,1-2H3,(H2,16,20,21) |
| InChIKey | FTNOBRDDEORBIX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|