C20H25N3O4S2 — CID 30798711
2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1-propylbenzimidazole-5-sulfonamide (PubChem CID 30798711) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1-propylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1-propylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 30798711 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1-propylbenzimidazole-5-sulfonamide |
| SMILES | CCCn1c(SCCOc2ccc(OCC)cc2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H25N3O4S2/c1-3-11-23-19-10-9-17(29(21,24)25)14-18(19)22-20(23)28-13-12-27-16-7-5-15(6-8-16)26-4-2/h5-10,14H,3-4,11-13H2,1-2H3,(H2,21,24,25) |
| InChIKey | MKMPQZLWALCIHI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|