C17H20N4O2S2 — CID 41434117
1-propyl-2-(2-pyridin-2-ylethylsulfanyl)benzimidazole-5-sulfonamide (PubChem CID 41434117) has the molecular formula C17H20N4O2S2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 1-propyl-2-(2-pyridin-2-ylethylsulfanyl)benzimidazole-5-sulfonamide.
| Compound Name | 1-propyl-2-(2-pyridin-2-ylethylsulfanyl)benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 41434117 |
| Molecular Formula | C17H20N4O2S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-propyl-2-(2-pyridin-2-ylethylsulfanyl)benzimidazole-5-sulfonamide |
| SMILES | CCCn1c(SCCc2ccccn2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H20N4O2S2/c1-2-10-21-16-7-6-14(25(18,22)23)12-15(16)20-17(21)24-11-8-13-5-3-4-9-19-13/h3-7,9,12H,2,8,10-11H2,1H3,(H2,18,22,23) |
| InChIKey | JDMNVNPMPIZKCQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |