C20H24N4O3S2 — CID 30799052
N-ethyl-N-phenyl-2-(1-propyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 30799052) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-ethyl-N-phenyl-2-(1-propyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-ethyl-N-phenyl-2-(1-propyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 30799052 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-ethyl-N-phenyl-2-(1-propyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCCn1c(SCC(=O)N(CC)c2ccccc2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H24N4O3S2/c1-3-12-24-18-11-10-16(29(21,26)27)13-17(18)22-20(24)28-14-19(25)23(4-2)15-8-6-5-7-9-15/h5-11,13H,3-4,12,14H2,1-2H3,(H2,21,26,27) |
| InChIKey | YNLSBYFRQPWLLM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |