C19H20N4O2S2 — CID 7506824
1-butyl-2-[(2-cyanophenyl)methylsulfanyl]benzimidazole-5-sulfonamide (PubChem CID 7506824) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-butyl-2-[(2-cyanophenyl)methylsulfanyl]benzimidazole-5-sulfonamide.
| Compound Name | 1-butyl-2-[(2-cyanophenyl)methylsulfanyl]benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 7506824 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1-butyl-2-[(2-cyanophenyl)methylsulfanyl]benzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(SCc2ccccc2C#N)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H20N4O2S2/c1-2-3-10-23-18-9-8-16(27(21,24)25)11-17(18)22-19(23)26-13-15-7-5-4-6-14(15)12-20/h4-9,11H,2-3,10,13H2,1H3,(H2,21,24,25) |
| InChIKey | KDCBMHKVDCBKDH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |