C20H19N3O2S2 — CID 7481486
1-ethyl-2-(naphthalen-1-ylmethylsulfanyl)benzimidazole-5-sulfonamide (PubChem CID 7481486) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 1-ethyl-2-(naphthalen-1-ylmethylsulfanyl)benzimidazole-5-sulfonamide.
| Compound Name | 1-ethyl-2-(naphthalen-1-ylmethylsulfanyl)benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 7481486 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-ethyl-2-(naphthalen-1-ylmethylsulfanyl)benzimidazole-5-sulfonamide |
| SMILES | CCn1c(SCc2cccc3ccccc23)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H19N3O2S2/c1-2-23-19-11-10-16(27(21,24)25)12-18(19)22-20(23)26-13-15-8-5-7-14-6-3-4-9-17(14)15/h3-12H,2,13H2,1H3,(H2,21,24,25) |
| InChIKey | UCMJVRHWAOWFGG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |