C16H24N4O3S2 — CID 7480908
2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide (PubChem CID 7480908) has the molecular formula C16H24N4O3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7480908 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-3-methylbutan-2-yl]acetamide |
| SMILES | CCn1c(SCC(=O)N[C@H](C)C(C)C)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C16H24N4O3S2/c1-5-20-14-7-6-12(25(17,22)23)8-13(14)19-16(20)24-9-15(21)18-11(4)10(2)3/h6-8,10-11H,5,9H2,1-4H3,(H,18,21)(H2,17,22,23)/t11-/m1/s1 |
| InChIKey | OUZHTQBBTKVWRK-LLVKDONJSA-N |
| XLogP | 1.96 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |