C23H34N4O3S2 — CID 55481888
N-cyclohexyl-3-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide (PubChem CID 55481888) has the molecular formula C23H34N4O3S2 and a molecular weight of 478.68 g/mol. Its IUPAC name is N-cyclohexyl-3-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide.
| Compound Name | N-cyclohexyl-3-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 55481888 |
| Molecular Formula | C23H34N4O3S2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-cyclohexyl-3-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide |
| SMILES | CCn1c(SCCC(=O)NC2CCCCC2)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H34N4O3S2/c1-2-27-21-12-11-19(32(29,30)26-14-7-4-8-15-26)17-20(21)25-23(27)31-16-13-22(28)24-18-9-5-3-6-10-18/h11-12,17-18H,2-10,13-16H2,1H3,(H,24,28) |
| InChIKey | NJHZMDBOQLAGAP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |