C27H30N4O3S2 — CID 4663274
2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(2-phenylphenyl)acetamide (PubChem CID 4663274) has the molecular formula C27H30N4O3S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 4663274 |
| Molecular Formula | C27H30N4O3S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(2-phenylphenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SCC(=O)Nc1ccccc1-c1ccccc1)n2CC |
| InChI | InChI=1S/C27H30N4O3S2/c1-4-30(5-2)36(33,34)21-16-17-25-24(18-21)29-27(31(25)6-3)35-19-26(32)28-23-15-11-10-14-22(23)20-12-8-7-9-13-20/h7-18H,4-6,19H2,1-3H3,(H,28,32) |
| InChIKey | AQHSQUNPAKZSLK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |