C26H36N4O3S2 — CID 16544116
N-benzyl-N-tert-butyl-2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylacetamide (PubChem CID 16544116) has the molecular formula C26H36N4O3S2 and a molecular weight of 516.73 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-benzyl-N-tert-butyl-2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 16544116 |
| Molecular Formula | C26H36N4O3S2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-benzyl-N-tert-butyl-2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SCC(=O)N(Cc1ccccc1)C(C)(C)C)n2CC |
| InChI | InChI=1S/C26H36N4O3S2/c1-7-28(8-2)35(32,33)21-15-16-23-22(17-21)27-25(29(23)9-3)34-19-24(31)30(26(4,5)6)18-20-13-11-10-12-14-20/h10-17H,7-9,18-19H2,1-6H3 |
| InChIKey | NDQSJSTVMZZGTG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |