C23H38N4O3S — CID 42972539
3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-heptan-2-ylpropanamide (PubChem CID 42972539) has the molecular formula C23H38N4O3S and a molecular weight of 450.65 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-heptan-2-ylpropanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-heptan-2-ylpropanamide |
|---|---|
| PubChem CID | 42972539 |
| Molecular Formula | C23H38N4O3S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-heptan-2-ylpropanamide |
| SMILES | CCCCCC(C)NC(=O)CCc1nc2cc(S(=O)(=O)N(CC)CC)ccc2n1CC |
| InChI | InChI=1S/C23H38N4O3S/c1-6-10-11-12-18(5)24-23(28)16-15-22-25-20-17-19(13-14-21(20)27(22)9-4)31(29,30)26(7-2)8-3/h13-14,17-18H,6-12,15-16H2,1-5H3,(H,24,28) |
| InChIKey | QBIZIZDISAUEJV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|