C24H40N4O3S — CID 43005369
3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(6-methylheptan-2-yl)propanamide (PubChem CID 43005369) has the molecular formula C24H40N4O3S and a molecular weight of 464.68 g/mol. Its IUPAC name is 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(6-methylheptan-2-yl)propanamide.
| Compound Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(6-methylheptan-2-yl)propanamide |
|---|---|
| PubChem CID | 43005369 |
| Molecular Formula | C24H40N4O3S |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(6-methylheptan-2-yl)propanamide |
| SMILES | CCCCn1c(CCC(=O)NC(C)CCCC(C)C)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C24H40N4O3S/c1-7-8-16-28-22-13-12-20(32(30,31)27(5)6)17-21(22)26-23(28)14-15-24(29)25-19(4)11-9-10-18(2)3/h12-13,17-19H,7-11,14-16H2,1-6H3,(H,25,29) |
| InChIKey | SOMCAZVRZXTFDJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |