C22H36N4O4S — CID 25330921
3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(3-propan-2-yloxypropyl)propanamide (PubChem CID 25330921) has the molecular formula C22H36N4O4S and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(3-propan-2-yloxypropyl)propanamide.
| Compound Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(3-propan-2-yloxypropyl)propanamide |
|---|---|
| PubChem CID | 25330921 |
| Molecular Formula | C22H36N4O4S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-(3-propan-2-yloxypropyl)propanamide |
| SMILES | CCCCn1c(CCC(=O)NCCCOC(C)C)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C22H36N4O4S/c1-6-7-14-26-20-10-9-18(31(28,29)25(4)5)16-19(20)24-21(26)11-12-22(27)23-13-8-15-30-17(2)3/h9-10,16-17H,6-8,11-15H2,1-5H3,(H,23,27) |
| InChIKey | REXJHTUCJJOGJO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|