C26H37N5O3S — CID 31103674
3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[3-(N-methylanilino)propyl]propanamide (PubChem CID 31103674) has the molecular formula C26H37N5O3S and a molecular weight of 499.68 g/mol. Its IUPAC name is 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[3-(N-methylanilino)propyl]propanamide.
| Compound Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[3-(N-methylanilino)propyl]propanamide |
|---|---|
| PubChem CID | 31103674 |
| Molecular Formula | C26H37N5O3S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[3-(N-methylanilino)propyl]propanamide |
| SMILES | CCCCn1c(CCC(=O)NCCCN(C)c2ccccc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C26H37N5O3S/c1-5-6-19-31-24-14-13-22(35(33,34)29(2)3)20-23(24)28-25(31)15-16-26(32)27-17-10-18-30(4)21-11-8-7-9-12-21/h7-9,11-14,20H,5-6,10,15-19H2,1-4H3,(H,27,32) |
| InChIKey | IYTLVLCOLFKSJR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|