C23H29ClN4O3S — CID 30697711
3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[(2-chlorophenyl)methyl]propanamide (PubChem CID 30697711) has the molecular formula C23H29ClN4O3S and a molecular weight of 477.03 g/mol. Its IUPAC name is 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[(2-chlorophenyl)methyl]propanamide.
| Compound Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[(2-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 30697711 |
| Molecular Formula | C23H29ClN4O3S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[(2-chlorophenyl)methyl]propanamide |
| SMILES | CCCCn1c(CCC(=O)NCc2ccccc2Cl)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C23H29ClN4O3S/c1-4-5-14-28-21-11-10-18(32(30,31)27(2)3)15-20(21)26-22(28)12-13-23(29)25-16-17-8-6-7-9-19(17)24/h6-11,15H,4-5,12-14,16H2,1-3H3,(H,25,29) |
| InChIKey | KGASIZOKSSQVCD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |