C24H31N7O3S — CID 55840043
3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]propanamide (PubChem CID 55840043) has the molecular formula C24H31N7O3S and a molecular weight of 497.63 g/mol. Its IUPAC name is 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]propanamide.
| Compound Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 55840043 |
| Molecular Formula | C24H31N7O3S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 3-[1-butyl-5-(dimethylsulfamoyl)benzimidazol-2-yl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]propanamide |
| SMILES | CCCCn1c(CCC(=O)NCCNc2ncccc2C#N)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C24H31N7O3S/c1-4-5-15-31-21-9-8-19(35(33,34)30(2)3)16-20(21)29-22(31)10-11-23(32)26-13-14-28-24-18(17-25)7-6-12-27-24/h6-9,12,16H,4-5,10-11,13-15H2,1-3H3,(H,26,32)(H,27,28) |
| InChIKey | OTESNDHSOPRZDC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|