C20H32N4O5S — CID 55454793
3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide (PubChem CID 55454793) has the molecular formula C20H32N4O5S and a molecular weight of 440.57 g/mol. Its IUPAC name is 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide.
| Compound Name | 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 55454793 |
| Molecular Formula | C20H32N4O5S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-[3-(2-methoxyethoxy)propyl]propanamide |
| SMILES | CCn1c(CCC(=O)NCCCOCCOC)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H32N4O5S/c1-5-24-18-8-7-16(30(26,27)23(2)3)15-17(18)22-19(24)9-10-20(25)21-11-6-12-29-14-13-28-4/h7-8,15H,5-6,9-14H2,1-4H3,(H,21,25) |
| InChIKey | LXSQMZDLPWSQHA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|