C17H24N4O5S — CID 119243818
(2R)-2-[3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoylamino]propanoic acid (PubChem CID 119243818) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is (2R)-2-[3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoylamino]propanoic acid.
| Compound Name | (2R)-2-[3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119243818 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (2R)-2-[3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanoylamino]propanoic acid |
| SMILES | CCn1c(CCC(=O)N[C@H](C)C(=O)O)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C17H24N4O5S/c1-5-21-14-7-6-12(27(25,26)20(3)4)10-13(14)19-15(21)8-9-16(22)18-11(2)17(23)24/h6-7,10-11H,5,8-9H2,1-4H3,(H,18,22)(H,23,24)/t11-/m1/s1 |
| InChIKey | VTWKUPSWMRQZED-LLVKDONJSA-N |
| XLogP | 0.83 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |