C27H30N4O3S — CID 4876131
N-benzhydryl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide (PubChem CID 4876131) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-benzhydryl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide.
| Compound Name | N-benzhydryl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
|---|---|
| PubChem CID | 4876131 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-benzhydryl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
| SMILES | CCn1c(CCC(=O)NC(c2ccccc2)c2ccccc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C27H30N4O3S/c1-4-31-24-16-15-22(35(33,34)30(2)3)19-23(24)28-25(31)17-18-26(32)29-27(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-16,19,27H,4,17-18H2,1-3H3,(H,29,32) |
| InChIKey | PHZFMBIDUOMULS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |