C19H30N4O3S — CID 75807833
N-butan-2-yl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-methylpropanamide (PubChem CID 75807833) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-butan-2-yl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-methylpropanamide.
| Compound Name | N-butan-2-yl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 75807833 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-butan-2-yl-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]-N-methylpropanamide |
| SMILES | CCC(C)N(C)C(=O)CCc1nc2cc(S(=O)(=O)N(C)C)ccc2n1CC |
| InChI | InChI=1S/C19H30N4O3S/c1-7-14(3)22(6)19(24)12-11-18-20-16-13-15(27(25,26)21(4)5)9-10-17(16)23(18)8-2/h9-10,13-14H,7-8,11-12H2,1-6H3 |
| InChIKey | LZSSXBSRQCCQKS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |