C22H27ClN4O3S2 — CID 27883780
N-[2-(4-chlorophenyl)sulfanylethyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide (PubChem CID 27883780) has the molecular formula C22H27ClN4O3S2 and a molecular weight of 495.07 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
|---|---|
| PubChem CID | 27883780 |
| Molecular Formula | C22H27ClN4O3S2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]propanamide |
| SMILES | CCn1c(CCC(=O)NCCSc2ccc(Cl)cc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C22H27ClN4O3S2/c1-4-27-20-10-9-18(32(29,30)26(2)3)15-19(20)25-21(27)11-12-22(28)24-13-14-31-17-7-5-16(23)6-8-17/h5-10,15H,4,11-14H2,1-3H3,(H,24,28) |
| InChIKey | ZPUXGBMXAIXRQR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|