C19H31N5O4S — CID 55445603
2-[[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl-methylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 55445603) has the molecular formula C19H31N5O4S and a molecular weight of 425.56 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl-methylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl-methylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55445603 |
| Molecular Formula | C19H31N5O4S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl-methylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | CCn1c(CN(C)CC(=O)NCCCOC)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C19H31N5O4S/c1-6-24-17-9-8-15(29(26,27)22(2)3)12-16(17)21-18(24)13-23(4)14-19(25)20-10-7-11-28-5/h8-9,12H,6-7,10-11,13-14H2,1-5H3,(H,20,25) |
| InChIKey | BRTNAIOMZWMBLR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|