C20H23N3O6S2 — CID 30000662
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-methylsulfonylbenzoate (PubChem CID 30000662) has the molecular formula C20H23N3O6S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-methylsulfonylbenzoate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 30000662 |
| Molecular Formula | C20H23N3O6S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-methylsulfonylbenzoate |
| SMILES | CCn1c(COC(=O)c2ccc(S(C)(=O)=O)cc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H23N3O6S2/c1-5-23-18-11-10-16(31(27,28)22(2)3)12-17(18)21-19(23)13-29-20(24)14-6-8-15(9-7-14)30(4,25)26/h6-12H,5,13H2,1-4H3 |
| InChIKey | SLJBRWKLVUNJQE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 115.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |