C24H24N4O6S — CID 27764250
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-(furan-2-carbonylamino)benzoate (PubChem CID 27764250) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-(furan-2-carbonylamino)benzoate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 27764250 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 4-(furan-2-carbonylamino)benzoate |
| SMILES | CCn1c(COC(=O)c2ccc(NC(=O)c3ccco3)cc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C24H24N4O6S/c1-4-28-20-12-11-18(35(31,32)27(2)3)14-19(20)26-22(28)15-34-24(30)16-7-9-17(10-8-16)25-23(29)21-6-5-13-33-21/h5-14H,4,15H2,1-3H3,(H,25,29) |
| InChIKey | WRUIROGAUKHUCA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |