C26H27N3O4S — CID 16560205
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzylbenzoate (PubChem CID 16560205) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzylbenzoate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzylbenzoate |
|---|---|
| PubChem CID | 16560205 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzylbenzoate |
| SMILES | CCn1c(COC(=O)c2ccccc2Cc2ccccc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C26H27N3O4S/c1-4-29-24-15-14-21(34(31,32)28(2)3)17-23(24)27-25(29)18-33-26(30)22-13-9-8-12-20(22)16-19-10-6-5-7-11-19/h5-15,17H,4,16,18H2,1-3H3 |
| InChIKey | BXOFVOCUHLKPPV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |