C24H25N3O4S — CID 46814027
[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl naphthalene-1-carboxylate (PubChem CID 46814027) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl naphthalene-1-carboxylate.
| Compound Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 46814027 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl naphthalene-1-carboxylate |
| SMILES | CCCn1c(COC(=O)c2cccc3ccccc23)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C24H25N3O4S/c1-4-14-27-22-13-12-18(32(29,30)26(2)3)15-21(22)25-23(27)16-31-24(28)20-11-7-9-17-8-5-6-10-19(17)20/h5-13,15H,4,14,16H2,1-3H3 |
| InChIKey | DEXSGBYFUYYEMM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |