C20H21Cl2N3O4S — CID 46814003
[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2,5-dichlorobenzoate (PubChem CID 46814003) has the molecular formula C20H21Cl2N3O4S and a molecular weight of 470.38 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2,5-dichlorobenzoate.
| Compound Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 46814003 |
| Molecular Formula | C20H21Cl2N3O4S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2,5-dichlorobenzoate |
| SMILES | CCCn1c(COC(=O)c2cc(Cl)ccc2Cl)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H21Cl2N3O4S/c1-4-9-25-18-8-6-14(30(27,28)24(2)3)11-17(18)23-19(25)12-29-20(26)15-10-13(21)5-7-16(15)22/h5-8,10-11H,4,9,12H2,1-3H3 |
| InChIKey | GJCNWOVNGGIXJD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |