C19H21ClN4O4S — CID 46660278
[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-chloropyridine-4-carboxylate (PubChem CID 46660278) has the molecular formula C19H21ClN4O4S and a molecular weight of 436.92 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-chloropyridine-4-carboxylate.
| Compound Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 46660278 |
| Molecular Formula | C19H21ClN4O4S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-chloropyridine-4-carboxylate |
| SMILES | CCCn1c(COC(=O)c2ccnc(Cl)c2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C19H21ClN4O4S/c1-4-9-24-16-6-5-14(29(26,27)23(2)3)11-15(16)22-18(24)12-28-19(25)13-7-8-21-17(20)10-13/h5-8,10-11H,4,9,12H2,1-3H3 |
| InChIKey | NXTPCEFVDDWRHR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|