C21H24N4O6S2 — CID 27005148
[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylsulfanyl-2-nitrobenzoate (PubChem CID 27005148) has the molecular formula C21H24N4O6S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylsulfanyl-2-nitrobenzoate.
| Compound Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylsulfanyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 27005148 |
| Molecular Formula | C21H24N4O6S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylsulfanyl-2-nitrobenzoate |
| SMILES | CCCn1c(COC(=O)c2cc(SC)ccc2[N+](=O)[O-])nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C21H24N4O6S2/c1-5-10-24-19-9-7-15(33(29,30)23(2)3)12-17(19)22-20(24)13-31-21(26)16-11-14(32-4)6-8-18(16)25(27)28/h6-9,11-12H,5,10,13H2,1-4H3 |
| InChIKey | BUUVCCAZGHPPLK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 124.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|