C20H26N6O6S — CID 43028604
[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 43028604) has the molecular formula C20H26N6O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 43028604 |
| Molecular Formula | C20H26N6O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | CCCn1c(COC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H26N6O6S/c1-6-9-24-17-8-7-15(33(30,31)23(4)5)10-16(17)21-18(24)12-32-19(27)11-25-14(3)20(26(28)29)13(2)22-25/h7-8,10H,6,9,11-12H2,1-5H3 |
| InChIKey | VFXLBSAZPVCGJI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 142.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|