C18H24N6O4S — CID 46818040
2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide (PubChem CID 46818040) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 46818040 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide |
| SMILES | CCCn1c(Cn2nc(C)c([N+](=O)[O-])c2C)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C18H24N6O4S/c1-6-9-22-16-8-7-14(29(27,28)21(4)5)10-15(16)19-17(22)11-23-13(3)18(24(25)26)12(2)20-23/h7-8,10H,6,9,11H2,1-5H3 |
| InChIKey | LJDQCFHNGDMGMV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 116.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|