C20H23N5O7S — CID 55667587
methyl 1-[[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55667587) has the molecular formula C20H23N5O7S and a molecular weight of 477.50 g/mol. Its IUPAC name is methyl 1-[[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55667587 |
| Molecular Formula | C20H23N5O7S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | methyl 1-[[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | CCCn1c(Cn2cc(C(=O)OC)cc([N+](=O)[O-])c2=O)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H23N5O7S/c1-5-8-24-16-7-6-14(33(30,31)22(2)3)10-15(16)21-18(24)12-23-11-13(20(27)32-4)9-17(19(23)26)25(28)29/h6-7,9-11H,5,8,12H2,1-4H3 |
| InChIKey | YFRZXIASNXPVGR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 146.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|