C19H23N3O4S2 — CID 46813798
[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylthiophene-2-carboxylate (PubChem CID 46813798) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylthiophene-2-carboxylate.
| Compound Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 46813798 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl 5-methylthiophene-2-carboxylate |
| SMILES | CCCn1c(COC(=O)c2ccc(C)s2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C19H23N3O4S2/c1-5-10-22-16-8-7-14(28(24,25)21(3)4)11-15(16)20-18(22)12-26-19(23)17-9-6-13(2)27-17/h6-9,11H,5,10,12H2,1-4H3 |
| InChIKey | ATALTULHDXUKPI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |