C20H27N3O4S — CID 46814865
[5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl cyclohex-3-ene-1-carboxylate (PubChem CID 46814865) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl cyclohex-3-ene-1-carboxylate.
| Compound Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 46814865 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-propylbenzimidazol-2-yl]methyl cyclohex-3-ene-1-carboxylate |
| SMILES | CCCn1c(COC(=O)C2CC=CCC2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H27N3O4S/c1-4-12-23-18-11-10-16(28(25,26)22(2)3)13-17(18)21-19(23)14-27-20(24)15-8-6-5-7-9-15/h5-6,10-11,13,15H,4,7-9,12,14H2,1-3H3 |
| InChIKey | LVJLGNLQHIAFQR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|