C18H20N4O4S — CID 18193380
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl pyridine-2-carboxylate (PubChem CID 18193380) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl pyridine-2-carboxylate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl pyridine-2-carboxylate |
|---|---|
| PubChem CID | 18193380 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl pyridine-2-carboxylate |
| SMILES | CCn1c(COC(=O)c2ccccn2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C18H20N4O4S/c1-4-22-16-9-8-13(27(24,25)21(2)3)11-15(16)20-17(22)12-26-18(23)14-7-5-6-10-19-14/h5-11H,4,12H2,1-3H3 |
| InChIKey | DLXMCNFFEPOIEX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |