C20H24N4O6S2 — CID 16560292
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 3-(methanesulfonamido)benzoate (PubChem CID 16560292) has the molecular formula C20H24N4O6S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 3-(methanesulfonamido)benzoate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 3-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 16560292 |
| Molecular Formula | C20H24N4O6S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 3-(methanesulfonamido)benzoate |
| SMILES | CCn1c(COC(=O)c2cccc(NS(C)(=O)=O)c2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C20H24N4O6S2/c1-5-24-18-10-9-16(32(28,29)23(2)3)12-17(18)21-19(24)13-30-20(25)14-7-6-8-15(11-14)22-31(4,26)27/h6-12,22H,5,13H2,1-4H3 |
| InChIKey | USUPREDTKOESEY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |