C22H26N4O5S — CID 24684554
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzamidopropanoate (PubChem CID 24684554) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzamidopropanoate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzamidopropanoate |
|---|---|
| PubChem CID | 24684554 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-benzamidopropanoate |
| SMILES | CCn1c(COC(=O)C(C)NC(=O)c2ccccc2)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C22H26N4O5S/c1-5-26-19-12-11-17(32(29,30)25(3)4)13-18(19)24-20(26)14-31-22(28)15(2)23-21(27)16-9-7-6-8-10-16/h6-13,15H,5,14H2,1-4H3,(H,23,27) |
| InChIKey | DECLLDQBXBTYSV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |